C16H22ClN3O3 — CID 119799043
2-(2-methoxyethylamino)-N-[1-(5-phenyl-1,3-oxazol-2-yl)ethyl]acetamide;hydrochloride (PubChem CID 119799043) has the molecular formula C16H22ClN3O3 and a molecular weight of 339.82 g/mol. Its IUPAC name is 2-(2-methoxyethylamino)-N-[1-(5-phenyl-1,3-oxazol-2-yl)ethyl]acetamide;hydrochloride.
| Compound Name | 2-(2-methoxyethylamino)-N-[1-(5-phenyl-1,3-oxazol-2-yl)ethyl]acetamide;hydrochloride |
|---|---|
| PubChem CID | 119799043 |
| Molecular Formula | C16H22ClN3O3 |
| Molecular Weight | 339.82 g/mol |
| Exact Mass | 339.13 |
| IUPAC Name | 2-(2-methoxyethylamino)-N-[1-(5-phenyl-1,3-oxazol-2-yl)ethyl]acetamide;hydrochloride |
| SMILES | COCCNCC(=O)NC(C)c1ncc(-c2ccccc2)o1.Cl |
| InChI | InChI=1S/C16H21N3O3.ClH/c1-12(19-15(20)11-17-8-9-21-2)16-18-10-14(22-16)13-6-4-3-5-7-13;/h3-7,10,12,17H,8-9,11H2,1-2H3,(H,19,20);1H |
| InChIKey | YAGANWSSUGJAAT-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.82 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|