C25H34N2O2 — CID 119802438
N-[1-[4-(2-methoxyphenyl)phenyl]ethyl]-N-methyl-3-piperidin-4-ylbutanamide (PubChem CID 119802438) has the molecular formula C25H34N2O2 and a molecular weight of 394.56 g/mol. Its IUPAC name is N-[1-[4-(2-methoxyphenyl)phenyl]ethyl]-N-methyl-3-piperidin-4-ylbutanamide.
| Compound Name | N-[1-[4-(2-methoxyphenyl)phenyl]ethyl]-N-methyl-3-piperidin-4-ylbutanamide |
|---|---|
| PubChem CID | 119802438 |
| Molecular Formula | C25H34N2O2 |
| Molecular Weight | 394.56 g/mol |
| Exact Mass | 394.26 |
| IUPAC Name | N-[1-[4-(2-methoxyphenyl)phenyl]ethyl]-N-methyl-3-piperidin-4-ylbutanamide |
| SMILES | COc1ccccc1-c1ccc(C(C)N(C)C(=O)CC(C)C2CCNCC2)cc1 |
| InChI | InChI=1S/C25H34N2O2/c1-18(20-13-15-26-16-14-20)17-25(28)27(3)19(2)21-9-11-22(12-10-21)23-7-5-6-8-24(23)29-4/h5-12,18-20,26H,13-17H2,1-4H3 |
| InChIKey | VIKRQNOPUNLYCO-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.56 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |