C14H27ClN2O3S — CID 119803169
3-amino-N-methyl-N-(2-methylsulfonylcyclohexyl)cyclopentane-1-carboxamide;hydrochloride (PubChem CID 119803169) has the molecular formula C14H27ClN2O3S and a molecular weight of 338.90 g/mol. Its IUPAC name is 3-amino-N-methyl-N-(2-methylsulfonylcyclohexyl)cyclopentane-1-carboxamide;hydrochloride.
| Compound Name | 3-amino-N-methyl-N-(2-methylsulfonylcyclohexyl)cyclopentane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119803169 |
| Molecular Formula | C14H27ClN2O3S |
| Molecular Weight | 338.90 g/mol |
| Exact Mass | 338.14 |
| IUPAC Name | 3-amino-N-methyl-N-(2-methylsulfonylcyclohexyl)cyclopentane-1-carboxamide;hydrochloride |
| SMILES | CN(C(=O)C1CCC(N)C1)C1CCCCC1S(C)(=O)=O.Cl |
| InChI | InChI=1S/C14H26N2O3S.ClH/c1-16(14(17)10-7-8-11(15)9-10)12-5-3-4-6-13(12)20(2,18)19;/h10-13H,3-9,15H2,1-2H3;1H |
| InChIKey | KCCNGKVGTDMGOI-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.90 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |