C11H20N2O3S — CID 96535798
3-cyclopropyl-1-methyl-1-[(1R,2R)-2-methylsulfonylcyclopentyl]urea (PubChem CID 96535798) has the molecular formula C11H20N2O3S and a molecular weight of 260.36 g/mol. Its IUPAC name is 3-cyclopropyl-1-methyl-1-[(1R,2R)-2-methylsulfonylcyclopentyl]urea.
| Compound Name | 3-cyclopropyl-1-methyl-1-[(1R,2R)-2-methylsulfonylcyclopentyl]urea |
|---|---|
| PubChem CID | 96535798 |
| Molecular Formula | C11H20N2O3S |
| Molecular Weight | 260.36 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | 3-cyclopropyl-1-methyl-1-[(1R,2R)-2-methylsulfonylcyclopentyl]urea |
| SMILES | CN(C(=O)NC1CC1)[C@@H]1CCC[C@H]1S(C)(=O)=O |
| InChI | InChI=1S/C11H20N2O3S/c1-13(11(14)12-8-6-7-8)9-4-3-5-10(9)17(2,15)16/h8-10H,3-7H2,1-2H3,(H,12,14)/t9-,10-/m1/s1 |
| InChIKey | KYGCNOVYSWLZGC-NXEZZACHSA-N |
| XLogP | 0.76 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.36 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |