C11H17N3O3S2 — CID 167969155
1-methyl-1-(2-methylsulfonylcyclopentyl)-3-(1,3-thiazol-2-yl)urea (PubChem CID 167969155) has the molecular formula C11H17N3O3S2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 1-methyl-1-(2-methylsulfonylcyclopentyl)-3-(1,3-thiazol-2-yl)urea.
| Compound Name | 1-methyl-1-(2-methylsulfonylcyclopentyl)-3-(1,3-thiazol-2-yl)urea |
|---|---|
| PubChem CID | 167969155 |
| Molecular Formula | C11H17N3O3S2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | 1-methyl-1-(2-methylsulfonylcyclopentyl)-3-(1,3-thiazol-2-yl)urea |
| SMILES | CN(C(=O)Nc1nccs1)C1CCCC1S(C)(=O)=O |
| InChI | InChI=1S/C11H17N3O3S2/c1-14(11(15)13-10-12-6-7-18-10)8-4-3-5-9(8)19(2,16)17/h6-9H,3-5H2,1-2H3,(H,12,13,15) |
| InChIKey | VGWIDECBOSMVLP-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |