C41H29F6N11O14 — CID 11980322
dimethyl 2,6-bis[2-[(2,4-dinitrophenyl)hydrazinylidene]-3-oxo-3-[3-(trifluoromethyl)anilino]propyl]pyridine-3,5-dicarboxylate (PubChem CID 11980322) has the molecular formula C41H29F6N11O14 and a molecular weight of 1013.73 g/mol. Its IUPAC name is dimethyl 2,6-bis[2-[(2,4-dinitrophenyl)hydrazinylidene]-3-oxo-3-[3-(trifluoromethyl)anilino]propyl]pyridine-3,5-dicarboxylate.
| Compound Name | dimethyl 2,6-bis[2-[(2,4-dinitrophenyl)hydrazinylidene]-3-oxo-3-[3-(trifluoromethyl)anilino]propyl]pyridine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 11980322 |
| Molecular Formula | C41H29F6N11O14 |
| Molecular Weight | 1013.73 g/mol |
| Exact Mass | 1013.18 |
| IUPAC Name | dimethyl 2,6-bis[2-[(2,4-dinitrophenyl)hydrazinylidene]-3-oxo-3-[3-(trifluoromethyl)anilino]propyl]pyridine-3,5-dicarboxylate |
| SMILES | COC(=O)c1cc(C(=O)OC)c(CC(=NNc2ccc([N+](=O)[O-])cc2[N+](=O)[O-])C(=O)Nc2cccc(C(F)(F)F)c2)nc1CC(=NNc1ccc([N+](=O)[O-])cc1[N+](=O)[O-])C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C41H29F6N11O14/c1-71-38(61)26-17-27(39(62)72-2)31(19-33(37(60)49-23-8-4-6-21(14-23)41(45,46)47)54-52-29-12-10-25(56(65)66)16-35(29)58(69)70)50-30(26)18-32(36(59)48-22-7-3-5-20(13-22)40(42,43)44)53-51-28-11-9-24(55(63)64)15-34(28)57(67)68/h3-17,51-52H,18-19H2,1-2H3,(H,48,59)(H,49,60) |
| InChIKey | LFMYDZYIINSCBQ-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 345.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 19 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 72 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1013.73 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 19 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|