C18H23F3N2O2 — CID 119806260
N-[1-[3-(trifluoromethyl)phenyl]cyclohexyl]morpholine-2-carboxamide (PubChem CID 119806260) has the molecular formula C18H23F3N2O2 and a molecular weight of 356.39 g/mol. Its IUPAC name is N-[1-[3-(trifluoromethyl)phenyl]cyclohexyl]morpholine-2-carboxamide.
| Compound Name | N-[1-[3-(trifluoromethyl)phenyl]cyclohexyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 119806260 |
| Molecular Formula | C18H23F3N2O2 |
| Molecular Weight | 356.39 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | N-[1-[3-(trifluoromethyl)phenyl]cyclohexyl]morpholine-2-carboxamide |
| SMILES | O=C(NC1(c2cccc(C(F)(F)F)c2)CCCCC1)C1CNCCO1 |
| InChI | InChI=1S/C18H23F3N2O2/c19-18(20,21)14-6-4-5-13(11-14)17(7-2-1-3-8-17)23-16(24)15-12-22-9-10-25-15/h4-6,11,15,22H,1-3,7-10,12H2,(H,23,24) |
| InChIKey | OEYGYJWAUJZZDM-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |