C13H23ClN2O2S — CID 119807395
2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl-(4-hydroxypyrrolidin-2-yl)methanone;hydrochloride (PubChem CID 119807395) has the molecular formula C13H23ClN2O2S and a molecular weight of 306.86 g/mol. Its IUPAC name is 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl-(4-hydroxypyrrolidin-2-yl)methanone;hydrochloride.
| Compound Name | 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl-(4-hydroxypyrrolidin-2-yl)methanone;hydrochloride |
|---|---|
| PubChem CID | 119807395 |
| Molecular Formula | C13H23ClN2O2S |
| Molecular Weight | 306.86 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl-(4-hydroxypyrrolidin-2-yl)methanone;hydrochloride |
| SMILES | Cl.O=C(C1CC(O)CN1)N1CCSC2CCCCC21 |
| InChI | InChI=1S/C13H22N2O2S.ClH/c16-9-7-10(14-8-9)13(17)15-5-6-18-12-4-2-1-3-11(12)15;/h9-12,14,16H,1-8H2;1H |
| InChIKey | ICTKQWQSMSVXPN-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.86 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |