C18H31ClN2OS — CID 120992046
2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl-(9-amino-3-bicyclo[3.3.1]nonanyl)methanone;hydrochloride (PubChem CID 120992046) has the molecular formula C18H31ClN2OS and a molecular weight of 358.98 g/mol. Its IUPAC name is 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl-(9-amino-3-bicyclo[3.3.1]nonanyl)methanone;hydrochloride.
| Compound Name | 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl-(9-amino-3-bicyclo[3.3.1]nonanyl)methanone;hydrochloride |
|---|---|
| PubChem CID | 120992046 |
| Molecular Formula | C18H31ClN2OS |
| Molecular Weight | 358.98 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl-(9-amino-3-bicyclo[3.3.1]nonanyl)methanone;hydrochloride |
| SMILES | Cl.NC1C2CCCC1CC(C(=O)N1CCSC3CCCCC31)C2 |
| InChI | InChI=1S/C18H30N2OS.ClH/c19-17-12-4-3-5-13(17)11-14(10-12)18(21)20-8-9-22-16-7-2-1-6-15(16)20;/h12-17H,1-11,19H2;1H |
| InChIKey | SRBCIRWFZKJASX-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.98 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |