C19H31N3O2S — CID 120990209
[1-(9-aminobicyclo[3.3.1]nonane-3-carbonyl)pyrrolidin-2-yl]-thiomorpholin-4-ylmethanone (PubChem CID 120990209) has the molecular formula C19H31N3O2S and a molecular weight of 365.54 g/mol. Its IUPAC name is [1-(9-aminobicyclo[3.3.1]nonane-3-carbonyl)pyrrolidin-2-yl]-thiomorpholin-4-ylmethanone.
| Compound Name | [1-(9-aminobicyclo[3.3.1]nonane-3-carbonyl)pyrrolidin-2-yl]-thiomorpholin-4-ylmethanone |
|---|---|
| PubChem CID | 120990209 |
| Molecular Formula | C19H31N3O2S |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | [1-(9-aminobicyclo[3.3.1]nonane-3-carbonyl)pyrrolidin-2-yl]-thiomorpholin-4-ylmethanone |
| SMILES | NC1C2CCCC1CC(C(=O)N1CCCC1C(=O)N1CCSCC1)C2 |
| InChI | InChI=1S/C19H31N3O2S/c20-17-13-3-1-4-14(17)12-15(11-13)18(23)22-6-2-5-16(22)19(24)21-7-9-25-10-8-21/h13-17H,1-12,20H2 |
| InChIKey | VUJSETOQFVHQPR-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 66.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |