C15H26N2OS — CID 120636655
2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl-[(2S,4S)-2-methylpiperidin-4-yl]methanone (PubChem CID 120636655) has the molecular formula C15H26N2OS and a molecular weight of 282.45 g/mol. Its IUPAC name is 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl-[(2S,4S)-2-methylpiperidin-4-yl]methanone.
| Compound Name | 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl-[(2S,4S)-2-methylpiperidin-4-yl]methanone |
|---|---|
| PubChem CID | 120636655 |
| Molecular Formula | C15H26N2OS |
| Molecular Weight | 282.45 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 2,3,4a,5,6,7,8,8a-octahydrobenzo[b][1,4]thiazin-4-yl-[(2S,4S)-2-methylpiperidin-4-yl]methanone |
| SMILES | C[C@H]1C[C@@H](C(=O)N2CCSC3CCCCC32)CCN1 |
| InChI | InChI=1S/C15H26N2OS/c1-11-10-12(6-7-16-11)15(18)17-8-9-19-14-5-3-2-4-13(14)17/h11-14,16H,2-10H2,1H3/t11-,12-,13?,14?/m0/s1 |
| InChIKey | BNVJLLMYKGEZSN-FEPKRQSRSA-N |
| XLogP | 2.26 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.45 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |