C26H13FeNO3-10 — CID 11980798
cyclopenta-1,3-diene;2-cyclopent-3-en-1-yl-6-oxo-3,5-diphenyl-1,3-oxazin-3-ium-4-olate;iron (PubChem CID 11980798) has the molecular formula C26H13FeNO3-10 and a molecular weight of 443.24 g/mol. Its IUPAC name is cyclopenta-1,3-diene;2-cyclopent-3-en-1-yl-6-oxo-3,5-diphenyl-1,3-oxazin-3-ium-4-olate;iron.
| Compound Name | cyclopenta-1,3-diene;2-cyclopent-3-en-1-yl-6-oxo-3,5-diphenyl-1,3-oxazin-3-ium-4-olate;iron |
|---|---|
| PubChem CID | 11980798 |
| Molecular Formula | C26H13FeNO3-10 |
| Molecular Weight | 443.24 g/mol |
| Exact Mass | 443.03 |
| IUPAC Name | cyclopenta-1,3-diene;2-cyclopent-3-en-1-yl-6-oxo-3,5-diphenyl-1,3-oxazin-3-ium-4-olate;iron |
| SMILES | O=c1oc([C-]2[CH-][C-]=[C-][CH-]2)[n+](-c2ccccc2)c([O-])c1-c1ccccc1.[Fe].[c-]1[c-][c-][cH-][c-]1 |
| InChI | InChI=1S/C21H13NO3.C5H.Fe/c23-19-18(15-9-3-1-4-10-15)21(24)25-20(16-11-7-8-12-16)22(19)17-13-5-2-6-14-17;1-2-4-5-3-1;/h1-6,9-14,23H;1H;/q-4;-5;/p-1 |
| InChIKey | KKZITEJKJCDGHM-UHFFFAOYSA-M |
| XLogP | 2.77 |
| TPSA | 57.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.24 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|