C24H18NO3+ — CID 135499854
4-hydroxy-3,5-diphenyl-2-[(E)-2-phenylethenyl]-1,3-oxazin-3-ium-6-one (PubChem CID 135499854) has the molecular formula C24H18NO3+ and a molecular weight of 368.41 g/mol. Its IUPAC name is 4-hydroxy-3,5-diphenyl-2-[(E)-2-phenylethenyl]-1,3-oxazin-3-ium-6-one.
| Compound Name | 4-hydroxy-3,5-diphenyl-2-[(E)-2-phenylethenyl]-1,3-oxazin-3-ium-6-one |
|---|---|
| PubChem CID | 135499854 |
| Molecular Formula | C24H18NO3+ |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 4-hydroxy-3,5-diphenyl-2-[(E)-2-phenylethenyl]-1,3-oxazin-3-ium-6-one |
| SMILES | O=c1oc(/C=C/c2ccccc2)[n+](-c2ccccc2)c(O)c1-c1ccccc1 |
| InChI | InChI=1S/C24H17NO3/c26-23-22(19-12-6-2-7-13-19)24(27)28-21(17-16-18-10-4-1-5-11-18)25(23)20-14-8-3-9-15-20/h1-17H/p+1/b17-16+ |
| InChIKey | ATAXFHNHFZKWJA-WUKNDPDISA-O |
| XLogP | 4.46 |
| TPSA | 54.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|