C13H8F6NO5Tl — CID 11981962
(3-formyl-1H-indol-4-yl)thallium;bis(2,2,2-trifluoroacetic acid) (PubChem CID 11981962) has the molecular formula C13H8F6NO5Tl and a molecular weight of 576.58 g/mol. Its IUPAC name is (3-formyl-1H-indol-4-yl)thallium;bis(2,2,2-trifluoroacetic acid).
| Compound Name | (3-formyl-1H-indol-4-yl)thallium;bis(2,2,2-trifluoroacetic acid) |
|---|---|
| PubChem CID | 11981962 |
| Molecular Formula | C13H8F6NO5Tl |
| Molecular Weight | 576.58 g/mol |
| Exact Mass | 577.01 |
| IUPAC Name | (3-formyl-1H-indol-4-yl)thallium;bis(2,2,2-trifluoroacetic acid) |
| SMILES | O=C(O)C(F)(F)F.O=C(O)C(F)(F)F.O=Cc1c[nH]c2cccc([Tl])c12 |
| InChI | InChI=1S/C9H6NO.2C2HF3O2.Tl/c11-6-7-5-10-9-4-2-1-3-8(7)9;2*3-2(4,5)1(6)7;/h1-2,4-6,10H;2*(H,6,7); |
| InChIKey | DMKJTCKDFYKHSM-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 107.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.58 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|