C10H14BrN3O2 — CID 119821015
3-amino-N-(5-bromo-1-methyl-6-oxo-3-pyridinyl)butanamide (PubChem CID 119821015) has the molecular formula C10H14BrN3O2 and a molecular weight of 288.15 g/mol. Its IUPAC name is 3-amino-N-(5-bromo-1-methyl-6-oxo-3-pyridinyl)butanamide.
| Compound Name | 3-amino-N-(5-bromo-1-methyl-6-oxo-3-pyridinyl)butanamide |
|---|---|
| PubChem CID | 119821015 |
| Molecular Formula | C10H14BrN3O2 |
| Molecular Weight | 288.15 g/mol |
| Exact Mass | 287.03 |
| IUPAC Name | 3-amino-N-(5-bromo-1-methyl-6-oxo-3-pyridinyl)butanamide |
| SMILES | CC(N)CC(=O)Nc1cc(Br)c(=O)n(C)c1 |
| InChI | InChI=1S/C10H14BrN3O2/c1-6(12)3-9(15)13-7-4-8(11)10(16)14(2)5-7/h4-6H,3,12H2,1-2H3,(H,13,15) |
| InChIKey | IHDXWJLGGWFFAJ-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.15 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |