C21H34ClN3O3 — CID 119821255
3-amino-N-[4-[1-(4-ethoxyphenyl)ethylamino]-4-oxobutyl]cyclohexane-1-carboxamide;hydrochloride (PubChem CID 119821255) has the molecular formula C21H34ClN3O3 and a molecular weight of 411.97 g/mol. Its IUPAC name is 3-amino-N-[4-[1-(4-ethoxyphenyl)ethylamino]-4-oxobutyl]cyclohexane-1-carboxamide;hydrochloride.
| Compound Name | 3-amino-N-[4-[1-(4-ethoxyphenyl)ethylamino]-4-oxobutyl]cyclohexane-1-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119821255 |
| Molecular Formula | C21H34ClN3O3 |
| Molecular Weight | 411.97 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 3-amino-N-[4-[1-(4-ethoxyphenyl)ethylamino]-4-oxobutyl]cyclohexane-1-carboxamide;hydrochloride |
| SMILES | CCOc1ccc(C(C)NC(=O)CCCNC(=O)C2CCCC(N)C2)cc1.Cl |
| InChI | InChI=1S/C21H33N3O3.ClH/c1-3-27-19-11-9-16(10-12-19)15(2)24-20(25)8-5-13-23-21(26)17-6-4-7-18(22)14-17;/h9-12,15,17-18H,3-8,13-14,22H2,1-2H3,(H,23,26)(H,24,25);1H |
| InChIKey | MHIYJYHUABSYSV-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.97 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|