C13H25ClN2O2 — CID 119822199
N-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl)-4-(methylamino)butanamide;hydrochloride (PubChem CID 119822199) has the molecular formula C13H25ClN2O2 and a molecular weight of 276.81 g/mol. Its IUPAC name is N-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl)-4-(methylamino)butanamide;hydrochloride.
| Compound Name | N-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl)-4-(methylamino)butanamide;hydrochloride |
|---|---|
| PubChem CID | 119822199 |
| Molecular Formula | C13H25ClN2O2 |
| Molecular Weight | 276.81 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | N-(2,3,3a,4,5,6,7,7a-octahydro-1-benzofuran-4-yl)-4-(methylamino)butanamide;hydrochloride |
| SMILES | CNCCCC(=O)NC1CCCC2OCCC12.Cl |
| InChI | InChI=1S/C13H24N2O2.ClH/c1-14-8-3-6-13(16)15-11-4-2-5-12-10(11)7-9-17-12;/h10-12,14H,2-9H2,1H3,(H,15,16);1H |
| InChIKey | WJOCXKAHYZOAKO-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.81 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|