C10H21ClN2O3S — CID 119822651
3-amino-N-[2-(cyclopropylmethylsulfonyl)ethyl]butanamide;hydrochloride (PubChem CID 119822651) has the molecular formula C10H21ClN2O3S and a molecular weight of 284.81 g/mol. Its IUPAC name is 3-amino-N-[2-(cyclopropylmethylsulfonyl)ethyl]butanamide;hydrochloride.
| Compound Name | 3-amino-N-[2-(cyclopropylmethylsulfonyl)ethyl]butanamide;hydrochloride |
|---|---|
| PubChem CID | 119822651 |
| Molecular Formula | C10H21ClN2O3S |
| Molecular Weight | 284.81 g/mol |
| Exact Mass | 284.10 |
| IUPAC Name | 3-amino-N-[2-(cyclopropylmethylsulfonyl)ethyl]butanamide;hydrochloride |
| SMILES | CC(N)CC(=O)NCCS(=O)(=O)CC1CC1.Cl |
| InChI | InChI=1S/C10H20N2O3S.ClH/c1-8(11)6-10(13)12-4-5-16(14,15)7-9-2-3-9;/h8-9H,2-7,11H2,1H3,(H,12,13);1H |
| InChIKey | FRFLCPQEVWPQGJ-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.81 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |