C17H32Cl2N4OS — CID 119831153
7-amino-N-[4-[(3-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]heptanamide;dihydrochloride (PubChem CID 119831153) has the molecular formula C17H32Cl2N4OS and a molecular weight of 411.44 g/mol. Its IUPAC name is 7-amino-N-[4-[(3-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]heptanamide;dihydrochloride.
| Compound Name | 7-amino-N-[4-[(3-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]heptanamide;dihydrochloride |
|---|---|
| PubChem CID | 119831153 |
| Molecular Formula | C17H32Cl2N4OS |
| Molecular Weight | 411.44 g/mol |
| Exact Mass | 410.17 |
| IUPAC Name | 7-amino-N-[4-[(3-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]heptanamide;dihydrochloride |
| SMILES | CC1CCCN(Cc2csc(NC(=O)CCCCCCN)n2)C1.Cl.Cl |
| InChI | InChI=1S/C17H30N4OS.2ClH/c1-14-7-6-10-21(11-14)12-15-13-23-17(19-15)20-16(22)8-4-2-3-5-9-18;;/h13-14H,2-12,18H2,1H3,(H,19,20,22);2*1H |
| InChIKey | HFEGNFUFFUJPIV-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|