C23H28N4O3S — CID 46680128
4-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[4-[(3-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]butanamide (PubChem CID 46680128) has the molecular formula C23H28N4O3S and a molecular weight of 440.57 g/mol. Its IUPAC name is 4-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[4-[(3-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]butanamide.
| Compound Name | 4-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[4-[(3-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]butanamide |
|---|---|
| PubChem CID | 46680128 |
| Molecular Formula | C23H28N4O3S |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.19 |
| IUPAC Name | 4-(5-methyl-1,3-dioxoisoindol-2-yl)-N-[4-[(3-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]butanamide |
| SMILES | Cc1ccc2c(c1)C(=O)N(CCCC(=O)Nc1nc(CN3CCCC(C)C3)cs1)C2=O |
| InChI | InChI=1S/C23H28N4O3S/c1-15-7-8-18-19(11-15)22(30)27(21(18)29)10-4-6-20(28)25-23-24-17(14-31-23)13-26-9-3-5-16(2)12-26/h7-8,11,14,16H,3-6,9-10,12-13H2,1-2H3,(H,24,25,28) |
| InChIKey | ABUDMADCQPAFOR-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|