C19H28Cl2N4OS — CID 120612022
3-(2-aminophenyl)-N-[4-[(3-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]propanamide;dihydrochloride (PubChem CID 120612022) has the molecular formula C19H28Cl2N4OS and a molecular weight of 431.43 g/mol. Its IUPAC name is 3-(2-aminophenyl)-N-[4-[(3-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]propanamide;dihydrochloride.
| Compound Name | 3-(2-aminophenyl)-N-[4-[(3-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]propanamide;dihydrochloride |
|---|---|
| PubChem CID | 120612022 |
| Molecular Formula | C19H28Cl2N4OS |
| Molecular Weight | 431.43 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | 3-(2-aminophenyl)-N-[4-[(3-methylpiperidin-1-yl)methyl]-1,3-thiazol-2-yl]propanamide;dihydrochloride |
| SMILES | CC1CCCN(Cc2csc(NC(=O)CCc3ccccc3N)n2)C1.Cl.Cl |
| InChI | InChI=1S/C19H26N4OS.2ClH/c1-14-5-4-10-23(11-14)12-16-13-25-19(21-16)22-18(24)9-8-15-6-2-3-7-17(15)20;;/h2-3,6-7,13-14H,4-5,8-12,20H2,1H3,(H,21,22,24);2*1H |
| InChIKey | ZXZCGQXCNKQLMJ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.43 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|