C18H26N4O3 — CID 119840351
N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]morpholine-2-carboxamide (PubChem CID 119840351) has the molecular formula C18H26N4O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]morpholine-2-carboxamide.
| Compound Name | N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 119840351 |
| Molecular Formula | C18H26N4O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | N-[1-(2-anilino-2-oxoethyl)piperidin-4-yl]morpholine-2-carboxamide |
| SMILES | O=C(CN1CCC(NC(=O)C2CNCCO2)CC1)Nc1ccccc1 |
| InChI | InChI=1S/C18H26N4O3/c23-17(20-14-4-2-1-3-5-14)13-22-9-6-15(7-10-22)21-18(24)16-12-19-8-11-25-16/h1-5,15-16,19H,6-13H2,(H,20,23)(H,21,24) |
| InChIKey | RESJPHKIYLYDAX-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |