C14H33Cl2N3O — CID 119842280
(2S)-2-amino-N-[2-(diethylamino)-4-methylpentyl]butanamide;dihydrochloride (PubChem CID 119842280) has the molecular formula C14H33Cl2N3O and a molecular weight of 330.34 g/mol. Its IUPAC name is (2S)-2-amino-N-[2-(diethylamino)-4-methylpentyl]butanamide;dihydrochloride.
| Compound Name | (2S)-2-amino-N-[2-(diethylamino)-4-methylpentyl]butanamide;dihydrochloride |
|---|---|
| PubChem CID | 119842280 |
| Molecular Formula | C14H33Cl2N3O |
| Molecular Weight | 330.34 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | (2S)-2-amino-N-[2-(diethylamino)-4-methylpentyl]butanamide;dihydrochloride |
| SMILES | CC[C@H](N)C(=O)NCC(CC(C)C)N(CC)CC.Cl.Cl |
| InChI | InChI=1S/C14H31N3O.2ClH/c1-6-13(15)14(18)16-10-12(9-11(4)5)17(7-2)8-3;;/h11-13H,6-10,15H2,1-5H3,(H,16,18);2*1H/t12?,13-;;/m0../s1 |
| InChIKey | HFDYLOSWUKEZJO-RIWFDJIXSA-N |
| XLogP | 2.44 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |