C20H30N4O3 — CID 119849198
N-[[3-(3-morpholin-4-ylpropanoylamino)phenyl]methyl]piperidine-2-carboxamide (PubChem CID 119849198) has the molecular formula C20H30N4O3 and a molecular weight of 374.49 g/mol. Its IUPAC name is N-[[3-(3-morpholin-4-ylpropanoylamino)phenyl]methyl]piperidine-2-carboxamide.
| Compound Name | N-[[3-(3-morpholin-4-ylpropanoylamino)phenyl]methyl]piperidine-2-carboxamide |
|---|---|
| PubChem CID | 119849198 |
| Molecular Formula | C20H30N4O3 |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.23 |
| IUPAC Name | N-[[3-(3-morpholin-4-ylpropanoylamino)phenyl]methyl]piperidine-2-carboxamide |
| SMILES | O=C(CCN1CCOCC1)Nc1cccc(CNC(=O)C2CCCCN2)c1 |
| InChI | InChI=1S/C20H30N4O3/c25-19(7-9-24-10-12-27-13-11-24)23-17-5-3-4-16(14-17)15-22-20(26)18-6-1-2-8-21-18/h3-5,14,18,21H,1-2,6-13,15H2,(H,22,26)(H,23,25) |
| InChIKey | SJHILMHBDIRNQE-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |