C22H33N3O5 — CID 48860718
N-[[3-(3-morpholin-4-ylpropanoylamino)phenyl]methyl]-2-(oxolan-2-ylmethoxy)propanamide (PubChem CID 48860718) has the molecular formula C22H33N3O5 and a molecular weight of 419.52 g/mol. Its IUPAC name is N-[[3-(3-morpholin-4-ylpropanoylamino)phenyl]methyl]-2-(oxolan-2-ylmethoxy)propanamide.
| Compound Name | N-[[3-(3-morpholin-4-ylpropanoylamino)phenyl]methyl]-2-(oxolan-2-ylmethoxy)propanamide |
|---|---|
| PubChem CID | 48860718 |
| Molecular Formula | C22H33N3O5 |
| Molecular Weight | 419.52 g/mol |
| Exact Mass | 419.24 |
| IUPAC Name | N-[[3-(3-morpholin-4-ylpropanoylamino)phenyl]methyl]-2-(oxolan-2-ylmethoxy)propanamide |
| SMILES | CC(OCC1CCCO1)C(=O)NCc1cccc(NC(=O)CCN2CCOCC2)c1 |
| InChI | InChI=1S/C22H33N3O5/c1-17(30-16-20-6-3-11-29-20)22(27)23-15-18-4-2-5-19(14-18)24-21(26)7-8-25-9-12-28-13-10-25/h2,4-5,14,17,20H,3,6-13,15-16H2,1H3,(H,23,27)(H,24,26) |
| InChIKey | WTZMIVDYCOOJDO-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.52 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |