C19H21Cl2FN4O — CID 119854445
N-[2-(4-fluorophenyl)-3H-benzimidazol-5-yl]piperidine-3-carboxamide;dihydrochloride (PubChem CID 119854445) has the molecular formula C19H21Cl2FN4O and a molecular weight of 411.31 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-3H-benzimidazol-5-yl]piperidine-3-carboxamide;dihydrochloride.
| Compound Name | N-[2-(4-fluorophenyl)-3H-benzimidazol-5-yl]piperidine-3-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119854445 |
| Molecular Formula | C19H21Cl2FN4O |
| Molecular Weight | 411.31 g/mol |
| Exact Mass | 410.11 |
| IUPAC Name | N-[2-(4-fluorophenyl)-3H-benzimidazol-5-yl]piperidine-3-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(Nc1ccc2nc(-c3ccc(F)cc3)[nH]c2c1)C1CCCNC1 |
| InChI | InChI=1S/C19H19FN4O.2ClH/c20-14-5-3-12(4-6-14)18-23-16-8-7-15(10-17(16)24-18)22-19(25)13-2-1-9-21-11-13;;/h3-8,10,13,21H,1-2,9,11H2,(H,22,25)(H,23,24);2*1H |
| InChIKey | ZGRDUMJPWJQWFF-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 69.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.31 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |