C24H21FN4O3 — CID 55848768
N-[2-(4-fluorophenyl)-3H-benzimidazol-5-yl]-1-(furan-3-carbonyl)piperidine-4-carboxamide (PubChem CID 55848768) has the molecular formula C24H21FN4O3 and a molecular weight of 432.46 g/mol. Its IUPAC name is N-[2-(4-fluorophenyl)-3H-benzimidazol-5-yl]-1-(furan-3-carbonyl)piperidine-4-carboxamide.
| Compound Name | N-[2-(4-fluorophenyl)-3H-benzimidazol-5-yl]-1-(furan-3-carbonyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55848768 |
| Molecular Formula | C24H21FN4O3 |
| Molecular Weight | 432.46 g/mol |
| Exact Mass | 432.16 |
| IUPAC Name | N-[2-(4-fluorophenyl)-3H-benzimidazol-5-yl]-1-(furan-3-carbonyl)piperidine-4-carboxamide |
| SMILES | O=C(Nc1ccc2nc(-c3ccc(F)cc3)[nH]c2c1)C1CCN(C(=O)c2ccoc2)CC1 |
| InChI | InChI=1S/C24H21FN4O3/c25-18-3-1-15(2-4-18)22-27-20-6-5-19(13-21(20)28-22)26-23(30)16-7-10-29(11-8-16)24(31)17-9-12-32-14-17/h1-6,9,12-14,16H,7-8,10-11H2,(H,26,30)(H,27,28) |
| InChIKey | ADKBSRSXGBXJRT-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 91.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |