C9H23Cl2N3O2 — CID 119855427
2-amino-N-[3-[2-methoxyethyl(methyl)amino]propyl]acetamide;dihydrochloride (PubChem CID 119855427) has the molecular formula C9H23Cl2N3O2 and a molecular weight of 276.21 g/mol. Its IUPAC name is 2-amino-N-[3-[2-methoxyethyl(methyl)amino]propyl]acetamide;dihydrochloride.
| Compound Name | 2-amino-N-[3-[2-methoxyethyl(methyl)amino]propyl]acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119855427 |
| Molecular Formula | C9H23Cl2N3O2 |
| Molecular Weight | 276.21 g/mol |
| Exact Mass | 275.12 |
| IUPAC Name | 2-amino-N-[3-[2-methoxyethyl(methyl)amino]propyl]acetamide;dihydrochloride |
| SMILES | COCCN(C)CCCNC(=O)CN.Cl.Cl |
| InChI | InChI=1S/C9H21N3O2.2ClH/c1-12(6-7-14-2)5-3-4-11-9(13)8-10;;/h3-8,10H2,1-2H3,(H,11,13);2*1H |
| InChIKey | JPYBJSFHDMABTK-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.21 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|