C18H24Cl2N4O3S — CID 119856097
(2R)-2-amino-1-[4-[[5-(2-nitrophenyl)thiophen-2-yl]methyl]piperazin-1-yl]propan-1-one;dihydrochloride (PubChem CID 119856097) has the molecular formula C18H24Cl2N4O3S and a molecular weight of 447.39 g/mol. Its IUPAC name is (2R)-2-amino-1-[4-[[5-(2-nitrophenyl)thiophen-2-yl]methyl]piperazin-1-yl]propan-1-one;dihydrochloride.
| Compound Name | (2R)-2-amino-1-[4-[[5-(2-nitrophenyl)thiophen-2-yl]methyl]piperazin-1-yl]propan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 119856097 |
| Molecular Formula | C18H24Cl2N4O3S |
| Molecular Weight | 447.39 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | (2R)-2-amino-1-[4-[[5-(2-nitrophenyl)thiophen-2-yl]methyl]piperazin-1-yl]propan-1-one;dihydrochloride |
| SMILES | C[C@@H](N)C(=O)N1CCN(Cc2ccc(-c3ccccc3[N+](=O)[O-])s2)CC1.Cl.Cl |
| InChI | InChI=1S/C18H22N4O3S.2ClH/c1-13(19)18(23)21-10-8-20(9-11-21)12-14-6-7-17(26-14)15-4-2-3-5-16(15)22(24)25;;/h2-7,13H,8-12,19H2,1H3;2*1H/t13-;;/m1../s1 |
| InChIKey | LAGGFRGACMDNHP-FFXKMJQXSA-N |
| XLogP | 3.16 |
| TPSA | 92.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.39 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|