C19H23N3O2S — CID 120907511
2-[[5-(2-nitrophenyl)thiophen-2-yl]methyl]-2,8-diazaspiro[4.5]decane (PubChem CID 120907511) has the molecular formula C19H23N3O2S and a molecular weight of 357.48 g/mol. Its IUPAC name is 2-[[5-(2-nitrophenyl)thiophen-2-yl]methyl]-2,8-diazaspiro[4.5]decane.
| Compound Name | 2-[[5-(2-nitrophenyl)thiophen-2-yl]methyl]-2,8-diazaspiro[4.5]decane |
|---|---|
| PubChem CID | 120907511 |
| Molecular Formula | C19H23N3O2S |
| Molecular Weight | 357.48 g/mol |
| Exact Mass | 357.15 |
| IUPAC Name | 2-[[5-(2-nitrophenyl)thiophen-2-yl]methyl]-2,8-diazaspiro[4.5]decane |
| SMILES | O=[N+]([O-])c1ccccc1-c1ccc(CN2CCC3(CCNCC3)C2)s1 |
| InChI | InChI=1S/C19H23N3O2S/c23-22(24)17-4-2-1-3-16(17)18-6-5-15(25-18)13-21-12-9-19(14-21)7-10-20-11-8-19/h1-6,20H,7-14H2 |
| InChIKey | ZZDSWPGHQKJCTC-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 58.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|