C18H24ClN3O2S — CID 120782272
3,3-dimethyl-1-[[5-(2-nitrophenyl)thiophen-2-yl]methyl]piperidin-4-amine;hydrochloride (PubChem CID 120782272) has the molecular formula C18H24ClN3O2S and a molecular weight of 381.93 g/mol. Its IUPAC name is 3,3-dimethyl-1-[[5-(2-nitrophenyl)thiophen-2-yl]methyl]piperidin-4-amine;hydrochloride.
| Compound Name | 3,3-dimethyl-1-[[5-(2-nitrophenyl)thiophen-2-yl]methyl]piperidin-4-amine;hydrochloride |
|---|---|
| PubChem CID | 120782272 |
| Molecular Formula | C18H24ClN3O2S |
| Molecular Weight | 381.93 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 3,3-dimethyl-1-[[5-(2-nitrophenyl)thiophen-2-yl]methyl]piperidin-4-amine;hydrochloride |
| SMILES | CC1(C)CN(Cc2ccc(-c3ccccc3[N+](=O)[O-])s2)CCC1N.Cl |
| InChI | InChI=1S/C18H23N3O2S.ClH/c1-18(2)12-20(10-9-17(18)19)11-13-7-8-16(24-13)14-5-3-4-6-15(14)21(22)23;/h3-8,17H,9-12,19H2,1-2H3;1H |
| InChIKey | WYFBXRZJMPUZQA-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.93 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|