C19H35Cl2N3OS — CID 119856145
N-[(1-thiomorpholin-4-ylcyclopentyl)methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride (PubChem CID 119856145) has the molecular formula C19H35Cl2N3OS and a molecular weight of 424.48 g/mol. Its IUPAC name is N-[(1-thiomorpholin-4-ylcyclopentyl)methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride.
| Compound Name | N-[(1-thiomorpholin-4-ylcyclopentyl)methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119856145 |
| Molecular Formula | C19H35Cl2N3OS |
| Molecular Weight | 424.48 g/mol |
| Exact Mass | 423.19 |
| IUPAC Name | N-[(1-thiomorpholin-4-ylcyclopentyl)methyl]-2,3,3a,4,5,6,7,7a-octahydro-1H-indole-2-carboxamide;dihydrochloride |
| SMILES | Cl.Cl.O=C(NCC1(N2CCSCC2)CCCC1)C1CC2CCCCC2N1 |
| InChI | InChI=1S/C19H33N3OS.2ClH/c23-18(17-13-15-5-1-2-6-16(15)21-17)20-14-19(7-3-4-8-19)22-9-11-24-12-10-22;;/h15-17,21H,1-14H2,(H,20,23);2*1H |
| InChIKey | UINPXWAGSJLKPF-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |