About benzene;chloroosmium;2-cyclohexylpiperidin-1-ide
benzene;chloroosmium;2-cyclohexylpiperidin-1-ide (PubChem CID 11985645) has the molecular formula C17H25ClNOs-2
and a molecular weight of 469.08 g/mol. Its IUPAC name is benzene;chloroosmium;2-cyclohexylpiperidin-1-ide.
Molecular Properties
| Compound Name | benzene;chloroosmium;2-cyclohexylpiperidin-1-ide |
| PubChem CID | 11985645 |
| Molecular Formula | C17H25ClNOs-2 |
| Molecular Weight | 469.08 g/mol |
| Exact Mass | 470.13 |
| IUPAC Name | benzene;chloroosmium;2-cyclohexylpiperidin-1-ide |
| SMILES | Cl[Os].[CH-]1CCCCC1C1CCCC[N-]1.c1ccccc1 |
| InChI | InChI=1S/C11H19N.C6H6.ClH.Os/c1-2-6-10(7-3-1)11-8-4-5-9-12-11;1-2-4-6-5-3-1;;/h6,10-11H,1-5,7-9H2;1-6H;1H;/q-2;;;+1/p-1 |
| InChIKey | LKTVJONCYVNVBS-UHFFFAOYSA-M |
| XLogP | 5.68 |
| TPSA | 14.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 469.08 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze benzene;chloroosmium;2-cyclohexylpiperidin-1-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzene;chloroosmium;2-cyclohexylpiperidin-1-ide?
The IUPAC name of benzene;chloroosmium;2-cyclohexylpiperidin-1-ide (CID 11985645) is benzene;chloroosmium;2-cyclohexylpiperidin-1-ide.
What is the SMILES notation for benzene;chloroosmium;2-cyclohexylpiperidin-1-ide?
The canonical SMILES for benzene;chloroosmium;2-cyclohexylpiperidin-1-ide is Cl[Os].[CH-]1CCCCC1C1CCCC[N-]1.c1ccccc1.
What is the InChIKey of benzene;chloroosmium;2-cyclohexylpiperidin-1-ide?
The InChIKey is LKTVJONCYVNVBS-UHFFFAOYSA-M. The full InChI is InChI=1S/C11H19N.C6H6.ClH.Os/c1-2-6-10(7-3-1)11-8-4-5-9-12-11;1-2-4-6-5-3-1;;/h6,10-11H,1-5,7-9H2;1-6H;1H;/q-2;;;+1/p-1.
What are the key properties of benzene;chloroosmium;2-cyclohexylpiperidin-1-ide?
benzene;chloroosmium;2-cyclohexylpiperidin-1-ide has a molecular weight of 469.08 g/mol, XLogP of 5.68, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for benzene;chloroosmium;2-cyclohexylpiperidin-1-ide is sourced from PubChem (CID 11985645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).