C15H15- — CID 11985683
1-(2-cyclopenta-2,4-dien-1-ylprop-1-enyl)-4-methylbenzene (PubChem CID 11985683) has the molecular formula C15H15- and a molecular weight of 195.28 g/mol. Its IUPAC name is 1-(2-cyclopenta-2,4-dien-1-ylprop-1-enyl)-4-methylbenzene.
| Compound Name | 1-(2-cyclopenta-2,4-dien-1-ylprop-1-enyl)-4-methylbenzene |
|---|---|
| PubChem CID | 11985683 |
| Molecular Formula | C15H15- |
| Molecular Weight | 195.28 g/mol |
| Exact Mass | 195.12 |
| IUPAC Name | 1-(2-cyclopenta-2,4-dien-1-ylprop-1-enyl)-4-methylbenzene |
| SMILES | CC(=Cc1ccc(C)cc1)[c-]1cccc1 |
| InChI | InChI=1S/C15H15/c1-12-7-9-14(10-8-12)11-13(2)15-5-3-4-6-15/h3-11H,1-2H3/q-1 |
| InChIKey | HGCQSOAQHUIGQD-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.28 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|