C19H31Cl2N3O3 — CID 119860967
4-methoxy-N-[4-(2-morpholin-4-ylethyl)phenyl]piperidine-4-carboxamide;dihydrochloride (PubChem CID 119860967) has the molecular formula C19H31Cl2N3O3 and a molecular weight of 420.38 g/mol. Its IUPAC name is 4-methoxy-N-[4-(2-morpholin-4-ylethyl)phenyl]piperidine-4-carboxamide;dihydrochloride.
| Compound Name | 4-methoxy-N-[4-(2-morpholin-4-ylethyl)phenyl]piperidine-4-carboxamide;dihydrochloride |
|---|---|
| PubChem CID | 119860967 |
| Molecular Formula | C19H31Cl2N3O3 |
| Molecular Weight | 420.38 g/mol |
| Exact Mass | 419.17 |
| IUPAC Name | 4-methoxy-N-[4-(2-morpholin-4-ylethyl)phenyl]piperidine-4-carboxamide;dihydrochloride |
| SMILES | COC1(C(=O)Nc2ccc(CCN3CCOCC3)cc2)CCNCC1.Cl.Cl |
| InChI | InChI=1S/C19H29N3O3.2ClH/c1-24-19(7-9-20-10-8-19)18(23)21-17-4-2-16(3-5-17)6-11-22-12-14-25-15-13-22;;/h2-5,20H,6-15H2,1H3,(H,21,23);2*1H |
| InChIKey | OBJGUZDYILCDBN-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 62.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.38 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |