C10H12F3N3O — CID 119861596
2-amino-N-[2-(2,2,2-trifluoroethylamino)phenyl]acetamide (PubChem CID 119861596) has the molecular formula C10H12F3N3O and a molecular weight of 247.22 g/mol. Its IUPAC name is 2-amino-N-[2-(2,2,2-trifluoroethylamino)phenyl]acetamide.
| Compound Name | 2-amino-N-[2-(2,2,2-trifluoroethylamino)phenyl]acetamide |
|---|---|
| PubChem CID | 119861596 |
| Molecular Formula | C10H12F3N3O |
| Molecular Weight | 247.22 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 2-amino-N-[2-(2,2,2-trifluoroethylamino)phenyl]acetamide |
| SMILES | NCC(=O)Nc1ccccc1NCC(F)(F)F |
| InChI | InChI=1S/C10H12F3N3O/c11-10(12,13)6-15-7-3-1-2-4-8(7)16-9(17)5-14/h1-4,15H,5-6,14H2,(H,16,17) |
| InChIKey | FKXMCURTTDWKLA-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.22 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |