C18H25N5O — CID 119866382
3-piperidin-4-yl-N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]butanamide (PubChem CID 119866382) has the molecular formula C18H25N5O and a molecular weight of 327.43 g/mol. Its IUPAC name is 3-piperidin-4-yl-N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]butanamide.
| Compound Name | 3-piperidin-4-yl-N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]butanamide |
|---|---|
| PubChem CID | 119866382 |
| Molecular Formula | C18H25N5O |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.21 |
| IUPAC Name | 3-piperidin-4-yl-N-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]butanamide |
| SMILES | CC(CC(=O)NCc1ccc(-n2cncn2)cc1)C1CCNCC1 |
| InChI | InChI=1S/C18H25N5O/c1-14(16-6-8-19-9-7-16)10-18(24)21-11-15-2-4-17(5-3-15)23-13-20-12-22-23/h2-5,12-14,16,19H,6-11H2,1H3,(H,21,24) |
| InChIKey | QNVJQIRHOYZEJF-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 71.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |