C24H32Cl2N4O — CID 119868689
N-[[4-(benzimidazol-1-ylmethyl)phenyl]methyl]-3-piperidin-4-ylbutanamide;dihydrochloride (PubChem CID 119868689) has the molecular formula C24H32Cl2N4O and a molecular weight of 463.45 g/mol. Its IUPAC name is N-[[4-(benzimidazol-1-ylmethyl)phenyl]methyl]-3-piperidin-4-ylbutanamide;dihydrochloride.
| Compound Name | N-[[4-(benzimidazol-1-ylmethyl)phenyl]methyl]-3-piperidin-4-ylbutanamide;dihydrochloride |
|---|---|
| PubChem CID | 119868689 |
| Molecular Formula | C24H32Cl2N4O |
| Molecular Weight | 463.45 g/mol |
| Exact Mass | 462.20 |
| IUPAC Name | N-[[4-(benzimidazol-1-ylmethyl)phenyl]methyl]-3-piperidin-4-ylbutanamide;dihydrochloride |
| SMILES | CC(CC(=O)NCc1ccc(Cn2cnc3ccccc32)cc1)C1CCNCC1.Cl.Cl |
| InChI | InChI=1S/C24H30N4O.2ClH/c1-18(21-10-12-25-13-11-21)14-24(29)26-15-19-6-8-20(9-7-19)16-28-17-27-22-4-2-3-5-23(22)28;;/h2-9,17-18,21,25H,10-16H2,1H3,(H,26,29);2*1H |
| InChIKey | ZQWOLVZBBFMTHR-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.45 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |