C13H13CoO4S3-3 — CID 11986854
cobalt;cyclopenta-1,3-diene;(E)-3-methoxy-1-[(Z)-3-methoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-ene-1,2-dithiolate (PubChem CID 11986854) has the molecular formula C13H13CoO4S3-3 and a molecular weight of 388.38 g/mol. Its IUPAC name is cobalt;cyclopenta-1,3-diene;(E)-3-methoxy-1-[(Z)-3-methoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-ene-1,2-dithiolate.
| Compound Name | cobalt;cyclopenta-1,3-diene;(E)-3-methoxy-1-[(Z)-3-methoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-ene-1,2-dithiolate |
|---|---|
| PubChem CID | 11986854 |
| Molecular Formula | C13H13CoO4S3-3 |
| Molecular Weight | 388.38 g/mol |
| Exact Mass | 387.93 |
| IUPAC Name | cobalt;cyclopenta-1,3-diene;(E)-3-methoxy-1-[(Z)-3-methoxy-3-oxoprop-1-enyl]sulfanyl-3-oxoprop-1-ene-1,2-dithiolate |
| SMILES | COC(=O)/C=C\S/C([S-])=C(/[S-])C(=O)OC.[Co].c1cc[cH-]c1 |
| InChI | InChI=1S/C8H10O4S3.C5H5.Co/c1-11-5(9)3-4-15-8(14)6(13)7(10)12-2;1-2-4-5-3-1;/h3-4,13-14H,1-2H3;1-5H;/q;-1;/p-2/b4-3-,8-6+;; |
| InChIKey | UMPRVAGSFISVMG-NNZXMICFSA-L |
| XLogP | 2.25 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.38 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|