C8H10O4S3 — CID 6914069
methyl (E)-3-[(Z)-3-methoxy-3-oxoprop-1-enyl]sulfanyl-2,3-bis(sulfanyl)prop-2-enoate (PubChem CID 6914069) has the molecular formula C8H10O4S3 and a molecular weight of 266.37 g/mol. Its IUPAC name is methyl (E)-3-[(Z)-3-methoxy-3-oxoprop-1-enyl]sulfanyl-2,3-bis(sulfanyl)prop-2-enoate.
| Compound Name | methyl (E)-3-[(Z)-3-methoxy-3-oxoprop-1-enyl]sulfanyl-2,3-bis(sulfanyl)prop-2-enoate |
|---|---|
| PubChem CID | 6914069 |
| Molecular Formula | C8H10O4S3 |
| Molecular Weight | 266.37 g/mol |
| Exact Mass | 265.97 |
| IUPAC Name | methyl (E)-3-[(Z)-3-methoxy-3-oxoprop-1-enyl]sulfanyl-2,3-bis(sulfanyl)prop-2-enoate |
| SMILES | COC(=O)/C=C\S/C(S)=C(/S)C(=O)OC |
| InChI | InChI=1S/C8H10O4S3/c1-11-5(9)3-4-15-8(14)6(13)7(10)12-2/h3-4,13-14H,1-2H3/b4-3-,8-6+ |
| InChIKey | PMUYZBNEOKBIFL-OONGGIDMSA-N |
| XLogP | 1.61 |
| TPSA | 52.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.37 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|