C22H26N4O — CID 119869593
N-[[2-[4-(imidazol-1-ylmethyl)phenyl]phenyl]methyl]-4-(methylamino)butanamide (PubChem CID 119869593) has the molecular formula C22H26N4O and a molecular weight of 362.48 g/mol. Its IUPAC name is N-[[2-[4-(imidazol-1-ylmethyl)phenyl]phenyl]methyl]-4-(methylamino)butanamide.
| Compound Name | N-[[2-[4-(imidazol-1-ylmethyl)phenyl]phenyl]methyl]-4-(methylamino)butanamide |
|---|---|
| PubChem CID | 119869593 |
| Molecular Formula | C22H26N4O |
| Molecular Weight | 362.48 g/mol |
| Exact Mass | 362.21 |
| IUPAC Name | N-[[2-[4-(imidazol-1-ylmethyl)phenyl]phenyl]methyl]-4-(methylamino)butanamide |
| SMILES | CNCCCC(=O)NCc1ccccc1-c1ccc(Cn2ccnc2)cc1 |
| InChI | InChI=1S/C22H26N4O/c1-23-12-4-7-22(27)25-15-20-5-2-3-6-21(20)19-10-8-18(9-11-19)16-26-14-13-24-17-26/h2-3,5-6,8-11,13-14,17,23H,4,7,12,15-16H2,1H3,(H,25,27) |
| InChIKey | HKOYQFIBWNFXKN-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 58.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|