C24H29N5O2 — CID 86969974
N-[3-[[2-[4-(imidazol-1-ylmethyl)phenyl]phenyl]methylcarbamoyl-methylamino]propyl]acetamide (PubChem CID 86969974) has the molecular formula C24H29N5O2 and a molecular weight of 419.53 g/mol. Its IUPAC name is N-[3-[[2-[4-(imidazol-1-ylmethyl)phenyl]phenyl]methylcarbamoyl-methylamino]propyl]acetamide.
| Compound Name | N-[3-[[2-[4-(imidazol-1-ylmethyl)phenyl]phenyl]methylcarbamoyl-methylamino]propyl]acetamide |
|---|---|
| PubChem CID | 86969974 |
| Molecular Formula | C24H29N5O2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.23 |
| IUPAC Name | N-[3-[[2-[4-(imidazol-1-ylmethyl)phenyl]phenyl]methylcarbamoyl-methylamino]propyl]acetamide |
| SMILES | CC(=O)NCCCN(C)C(=O)NCc1ccccc1-c1ccc(Cn2ccnc2)cc1 |
| InChI | InChI=1S/C24H29N5O2/c1-19(30)26-12-5-14-28(2)24(31)27-16-22-6-3-4-7-23(22)21-10-8-20(9-11-21)17-29-15-13-25-18-29/h3-4,6-11,13,15,18H,5,12,14,16-17H2,1-2H3,(H,26,30)(H,27,31) |
| InChIKey | ZZDMBPYEWLGELZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 79.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|