C14H22Cl3N3O — CID 119874360
4-amino-2-chloro-N-[2-[cyclopropyl(ethyl)amino]ethyl]benzamide;dihydrochloride (PubChem CID 119874360) has the molecular formula C14H22Cl3N3O and a molecular weight of 354.71 g/mol. Its IUPAC name is 4-amino-2-chloro-N-[2-[cyclopropyl(ethyl)amino]ethyl]benzamide;dihydrochloride.
| Compound Name | 4-amino-2-chloro-N-[2-[cyclopropyl(ethyl)amino]ethyl]benzamide;dihydrochloride |
|---|---|
| PubChem CID | 119874360 |
| Molecular Formula | C14H22Cl3N3O |
| Molecular Weight | 354.71 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 4-amino-2-chloro-N-[2-[cyclopropyl(ethyl)amino]ethyl]benzamide;dihydrochloride |
| SMILES | CCN(CCNC(=O)c1ccc(N)cc1Cl)C1CC1.Cl.Cl |
| InChI | InChI=1S/C14H20ClN3O.2ClH/c1-2-18(11-4-5-11)8-7-17-14(19)12-6-3-10(16)9-13(12)15;;/h3,6,9,11H,2,4-5,7-8,16H2,1H3,(H,17,19);2*1H |
| InChIKey | JYRXULVNLBOKLR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.71 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|