C22H31Cl2N3O2 — CID 119877064
2-(4-aminophenyl)-N-benzyl-N-(1-morpholin-4-ylpropan-2-yl)acetamide;dihydrochloride (PubChem CID 119877064) has the molecular formula C22H31Cl2N3O2 and a molecular weight of 440.42 g/mol. Its IUPAC name is 2-(4-aminophenyl)-N-benzyl-N-(1-morpholin-4-ylpropan-2-yl)acetamide;dihydrochloride.
| Compound Name | 2-(4-aminophenyl)-N-benzyl-N-(1-morpholin-4-ylpropan-2-yl)acetamide;dihydrochloride |
|---|---|
| PubChem CID | 119877064 |
| Molecular Formula | C22H31Cl2N3O2 |
| Molecular Weight | 440.42 g/mol |
| Exact Mass | 439.18 |
| IUPAC Name | 2-(4-aminophenyl)-N-benzyl-N-(1-morpholin-4-ylpropan-2-yl)acetamide;dihydrochloride |
| SMILES | CC(CN1CCOCC1)N(Cc1ccccc1)C(=O)Cc1ccc(N)cc1.Cl.Cl |
| InChI | InChI=1S/C22H29N3O2.2ClH/c1-18(16-24-11-13-27-14-12-24)25(17-20-5-3-2-4-6-20)22(26)15-19-7-9-21(23)10-8-19;;/h2-10,18H,11-17,23H2,1H3;2*1H |
| InChIKey | PLYLAXQVMNUVCW-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_no_alk(40)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|