C23H30N2O4S — CID 56500850
N-benzyl-4-(methylsulfonylmethyl)-N-(1-morpholin-4-ylpropan-2-yl)benzamide (PubChem CID 56500850) has the molecular formula C23H30N2O4S and a molecular weight of 430.57 g/mol. Its IUPAC name is N-benzyl-4-(methylsulfonylmethyl)-N-(1-morpholin-4-ylpropan-2-yl)benzamide.
| Compound Name | N-benzyl-4-(methylsulfonylmethyl)-N-(1-morpholin-4-ylpropan-2-yl)benzamide |
|---|---|
| PubChem CID | 56500850 |
| Molecular Formula | C23H30N2O4S |
| Molecular Weight | 430.57 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | N-benzyl-4-(methylsulfonylmethyl)-N-(1-morpholin-4-ylpropan-2-yl)benzamide |
| SMILES | CC(CN1CCOCC1)N(Cc1ccccc1)C(=O)c1ccc(CS(C)(=O)=O)cc1 |
| InChI | InChI=1S/C23H30N2O4S/c1-19(16-24-12-14-29-15-13-24)25(17-20-6-4-3-5-7-20)23(26)22-10-8-21(9-11-22)18-30(2,27)28/h3-11,19H,12-18H2,1-2H3 |
| InChIKey | BQXAMQBFMNMSCM-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.57 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |