C23H27F3N2O2 — CID 56500713
N-benzyl-N-(1-morpholin-4-ylpropan-2-yl)-2-[4-(trifluoromethyl)phenyl]acetamide (PubChem CID 56500713) has the molecular formula C23H27F3N2O2 and a molecular weight of 420.48 g/mol. Its IUPAC name is N-benzyl-N-(1-morpholin-4-ylpropan-2-yl)-2-[4-(trifluoromethyl)phenyl]acetamide.
| Compound Name | N-benzyl-N-(1-morpholin-4-ylpropan-2-yl)-2-[4-(trifluoromethyl)phenyl]acetamide |
|---|---|
| PubChem CID | 56500713 |
| Molecular Formula | C23H27F3N2O2 |
| Molecular Weight | 420.48 g/mol |
| Exact Mass | 420.20 |
| IUPAC Name | N-benzyl-N-(1-morpholin-4-ylpropan-2-yl)-2-[4-(trifluoromethyl)phenyl]acetamide |
| SMILES | CC(CN1CCOCC1)N(Cc1ccccc1)C(=O)Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H27F3N2O2/c1-18(16-27-11-13-30-14-12-27)28(17-20-5-3-2-4-6-20)22(29)15-19-7-9-21(10-8-19)23(24,25)26/h2-10,18H,11-17H2,1H3 |
| InChIKey | APNCNPCQENELDQ-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.48 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |