C14H18ClN5O2 — CID 119878835
4-amino-5-chloro-2-methoxy-N-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]benzamide (PubChem CID 119878835) has the molecular formula C14H18ClN5O2 and a molecular weight of 323.78 g/mol. Its IUPAC name is 4-amino-5-chloro-2-methoxy-N-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]benzamide.
| Compound Name | 4-amino-5-chloro-2-methoxy-N-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]benzamide |
|---|---|
| PubChem CID | 119878835 |
| Molecular Formula | C14H18ClN5O2 |
| Molecular Weight | 323.78 g/mol |
| Exact Mass | 323.11 |
| IUPAC Name | 4-amino-5-chloro-2-methoxy-N-[(4-propan-2-yl-1,2,4-triazol-3-yl)methyl]benzamide |
| SMILES | COc1cc(N)c(Cl)cc1C(=O)NCc1nncn1C(C)C |
| InChI | InChI=1S/C14H18ClN5O2/c1-8(2)20-7-18-19-13(20)6-17-14(21)9-4-10(15)11(16)5-12(9)22-3/h4-5,7-8H,6,16H2,1-3H3,(H,17,21) |
| InChIKey | RLMFJSVBEGKGEW-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.78 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|