C16H20ClN3O3 — CID 119821115
4-amino-5-chloro-N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-2-methoxybenzamide (PubChem CID 119821115) has the molecular formula C16H20ClN3O3 and a molecular weight of 337.81 g/mol. Its IUPAC name is 4-amino-5-chloro-N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-2-methoxybenzamide.
| Compound Name | 4-amino-5-chloro-N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 119821115 |
| Molecular Formula | C16H20ClN3O3 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 4-amino-5-chloro-N-[(3,5-diethyl-1,2-oxazol-4-yl)methyl]-2-methoxybenzamide |
| SMILES | CCc1noc(CC)c1CNC(=O)c1cc(Cl)c(N)cc1OC |
| InChI | InChI=1S/C16H20ClN3O3/c1-4-13-10(14(5-2)23-20-13)8-19-16(21)9-6-11(17)12(18)7-15(9)22-3/h6-7H,4-5,8,18H2,1-3H3,(H,19,21) |
| InChIKey | XDSIIVWVKMBCSY-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 90.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|