C13H29Cl2N3O2 — CID 119880381
(2S)-2-amino-1-[3-ethyl-4-(2-methoxyethyl)piperazin-1-yl]butan-1-one;dihydrochloride (PubChem CID 119880381) has the molecular formula C13H29Cl2N3O2 and a molecular weight of 330.30 g/mol. Its IUPAC name is (2S)-2-amino-1-[3-ethyl-4-(2-methoxyethyl)piperazin-1-yl]butan-1-one;dihydrochloride.
| Compound Name | (2S)-2-amino-1-[3-ethyl-4-(2-methoxyethyl)piperazin-1-yl]butan-1-one;dihydrochloride |
|---|---|
| PubChem CID | 119880381 |
| Molecular Formula | C13H29Cl2N3O2 |
| Molecular Weight | 330.30 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | (2S)-2-amino-1-[3-ethyl-4-(2-methoxyethyl)piperazin-1-yl]butan-1-one;dihydrochloride |
| SMILES | CCC1CN(C(=O)[C@@H](N)CC)CCN1CCOC.Cl.Cl |
| InChI | InChI=1S/C13H27N3O2.2ClH/c1-4-11-10-16(13(17)12(14)5-2)7-6-15(11)8-9-18-3;;/h11-12H,4-10,14H2,1-3H3;2*1H/t11?,12-;;/m0../s1 |
| InChIKey | LKEXGVTWPXVFMF-ZFYUWLNGSA-N |
| XLogP | 1.14 |
| TPSA | 58.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.30 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |