C11H23N3O — CID 79023529
(2R)-2-amino-1-(3-ethyl-4-methylpiperazin-1-yl)butan-1-one (PubChem CID 79023529) has the molecular formula C11H23N3O and a molecular weight of 213.32 g/mol. Its IUPAC name is (2R)-2-amino-1-(3-ethyl-4-methylpiperazin-1-yl)butan-1-one.
| Compound Name | (2R)-2-amino-1-(3-ethyl-4-methylpiperazin-1-yl)butan-1-one |
|---|---|
| PubChem CID | 79023529 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | (2R)-2-amino-1-(3-ethyl-4-methylpiperazin-1-yl)butan-1-one |
| SMILES | CCC1CN(C(=O)[C@H](N)CC)CCN1C |
| InChI | InChI=1S/C11H23N3O/c1-4-9-8-14(7-6-13(9)3)11(15)10(12)5-2/h9-10H,4-8,12H2,1-3H3/t9?,10-/m1/s1 |
| InChIKey | BLSKYFMXYJJXGB-QVDQXJPCSA-N |
| XLogP | 0.28 |
| TPSA | 49.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |